C12H21F6NO — CID 102723172
N-tert-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-amine (PubChem CID 102723172) has the molecular formula C12H21F6NO and a molecular weight of 309.29 g/mol. Its IUPAC name is N-tert-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-amine.
| Compound Name | N-tert-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-amine |
|---|---|
| PubChem CID | 102723172 |
| Molecular Formula | C12H21F6NO |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-tert-butyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-1-amine |
| SMILES | CC(CCCNC(C)(C)C)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H21F6NO/c1-8(6-5-7-19-10(2,3)4)20-9(11(13,14)15)12(16,17)18/h8-9,19H,5-7H2,1-4H3 |
| InChIKey | CCXZPWMPSUFQTJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|