C11H19F6NO2 — CID 102723322
4-ethoxy-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]butan-1-amine (PubChem CID 102723322) has the molecular formula C11H19F6NO2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]butan-1-amine.
| Compound Name | 4-ethoxy-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 102723322 |
| Molecular Formula | C11H19F6NO2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-ethoxy-N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]butan-1-amine |
| SMILES | CCOCCCCNCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F6NO2/c1-2-19-7-4-3-5-18-6-8-20-9(10(12,13)14)11(15,16)17/h9,18H,2-8H2,1H3 |
| InChIKey | SYIHSXNCSQEPDK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|