C9H13F6NO — CID 102723351
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-prop-2-enylpropan-1-amine (PubChem CID 102723351) has the molecular formula C9H13F6NO and a molecular weight of 265.20 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-prop-2-enylpropan-1-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-prop-2-enylpropan-1-amine |
|---|---|
| PubChem CID | 102723351 |
| Molecular Formula | C9H13F6NO |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-prop-2-enylpropan-1-amine |
| SMILES | C=CCNCC(C)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F6NO/c1-3-4-16-5-6(2)17-7(8(10,11)12)9(13,14)15/h3,6-7,16H,1,4-5H2,2H3 |
| InChIKey | UTUABZOGMVNJMV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|