C10H17F6NO2 — CID 102723359
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methoxyethyl)butan-1-amine (PubChem CID 102723359) has the molecular formula C10H17F6NO2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 102723359 |
| Molecular Formula | C10H17F6NO2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methoxyethyl)butan-1-amine |
| SMILES | COCCNCCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO2/c1-18-7-5-17-4-2-3-6-19-8(9(11,12)13)10(14,15)16/h8,17H,2-7H2,1H3 |
| InChIKey | CYWVVTVUZUYQTH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|