C9H11BrF6O — CID 102723544
2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,1-dimethylcyclobutane (PubChem CID 102723544) has the molecular formula C9H11BrF6O and a molecular weight of 329.08 g/mol. Its IUPAC name is 2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,1-dimethylcyclobutane.
| Compound Name | 2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,1-dimethylcyclobutane |
|---|---|
| PubChem CID | 102723544 |
| Molecular Formula | C9H11BrF6O |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,1-dimethylcyclobutane |
| SMILES | CC1(C)C(Br)CC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11BrF6O/c1-7(2)4(10)3-5(7)17-6(8(11,12)13)9(14,15)16/h4-6H,3H2,1-2H3 |
| InChIKey | BSHMIPDSHAKVBK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|