C11H7F6N3O — CID 102723646
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinazolin-2-amine (PubChem CID 102723646) has the molecular formula C11H7F6N3O and a molecular weight of 311.19 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinazolin-2-amine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinazolin-2-amine |
|---|---|
| PubChem CID | 102723646 |
| Molecular Formula | C11H7F6N3O |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinazolin-2-amine |
| SMILES | Nc1nc(OC(C(F)(F)F)C(F)(F)F)c2ccccc2n1 |
| InChI | InChI=1S/C11H7F6N3O/c12-10(13,14)8(11(15,16)17)21-7-5-3-1-2-4-6(5)19-9(18)20-7/h1-4,8H,(H2,18,19,20) |
| InChIKey | RJKANNNKNUCCHB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |