C10H11F6N3O — CID 102723658
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propylpyrazin-2-amine (PubChem CID 102723658) has the molecular formula C10H11F6N3O and a molecular weight of 303.21 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propylpyrazin-2-amine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propylpyrazin-2-amine |
|---|---|
| PubChem CID | 102723658 |
| Molecular Formula | C10H11F6N3O |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cncc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F6N3O/c1-2-3-18-6-4-17-5-7(19-6)20-8(9(11,12)13)10(14,15)16/h4-5,8H,2-3H2,1H3,(H,18,19) |
| InChIKey | RKSCOBCSPBZQBU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |