C11H12ClNO3 — CID 102724649
2-chloro-4-(2,2-dimethoxyethoxy)benzonitrile (PubChem CID 102724649) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 2-chloro-4-(2,2-dimethoxyethoxy)benzonitrile.
| Compound Name | 2-chloro-4-(2,2-dimethoxyethoxy)benzonitrile |
|---|---|
| PubChem CID | 102724649 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-chloro-4-(2,2-dimethoxyethoxy)benzonitrile |
| SMILES | COC(COc1ccc(C#N)c(Cl)c1)OC |
| InChI | InChI=1S/C11H12ClNO3/c1-14-11(15-2)7-16-9-4-3-8(6-13)10(12)5-9/h3-5,11H,7H2,1-2H3 |
| InChIKey | KPXSDKGHIZFYSS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|