C16H25N3 — CID 102725488
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-pyridin-3-ylethanamine (PubChem CID 102725488) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-pyridin-3-ylethanamine.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 102725488 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-pyridin-3-ylethanamine |
| SMILES | NCC(c1cccnc1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H25N3/c17-11-16(14-6-3-9-18-12-14)19-10-4-7-13-5-1-2-8-15(13)19/h3,6,9,12-13,15-16H,1-2,4-5,7-8,10-11,17H2/t13-,15-,16?/m1/s1 |
| InChIKey | NUJWNDXNTZGIQH-CWSLVUQWSA-N |
| XLogP | 2.74 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |