C17H26N2O — CID 102725506
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(3-aminophenyl)ethanol (PubChem CID 102725506) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(3-aminophenyl)ethanol.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(3-aminophenyl)ethanol |
|---|---|
| PubChem CID | 102725506 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(3-aminophenyl)ethanol |
| SMILES | Nc1cccc(C(O)CN2CCC[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C17H26N2O/c18-15-8-3-6-14(11-15)17(20)12-19-10-4-7-13-5-1-2-9-16(13)19/h3,6,8,11,13,16-17,20H,1-2,4-5,7,9-10,12,18H2/t13-,16-,17?/m1/s1 |
| InChIKey | ZJKKLDRPPCKFPF-ZIAVVELASA-N |
| XLogP | 2.96 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|