C18H28N2O — CID 102725578
[3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-methoxyphenyl]methanamine (PubChem CID 102725578) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is [3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-methoxyphenyl]methanamine.
| Compound Name | [3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 102725578 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | [3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN)cc1CN1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H28N2O/c1-21-18-9-8-14(12-19)11-16(18)13-20-10-4-6-15-5-2-3-7-17(15)20/h8-9,11,15,17H,2-7,10,12-13,19H2,1H3/t15-,17-/m1/s1 |
| InChIKey | MBLYRFACCYTDKC-NVXWUHKLSA-N |
| XLogP | 3.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |