C18H34N2 — CID 102726068
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,4,4-trimethylcyclohexan-1-amine (PubChem CID 102726068) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,4,4-trimethylcyclohexan-1-amine.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,4,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102726068 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,4,4-trimethylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)(C)CC1N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H34N2/c1-18(2)11-10-15(19-3)17(13-18)20-12-6-8-14-7-4-5-9-16(14)20/h14-17,19H,4-13H2,1-3H3/t14-,15?,16-,17?/m1/s1 |
| InChIKey | RCXGKGCMDOTFAZ-KZYLPZIUSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |