C27H35NO2 — CID 10272666
(4R)-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 10272666) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (4R)-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10272666 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (4R)-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\[C@@H]1COC(/C=C/c2ccccc2)=N1)OC |
| InChI | InChI=1S/C27H35NO2/c1-4-13-26(29-3)20-18-23(2)14-9-6-5-7-12-17-25-22-30-27(28-25)21-19-24-15-10-8-11-16-24/h4,6,8-12,14-17,19,21,25-26H,1,5,7,13,18,20,22H2,2-3H3/b9-6+,17-12-,21-19+,23-14+/t25-,26+/m1/s1 |
| InChIKey | VOYMXUPQIBWHBB-ISRIDXCJSA-N |
| XLogP | 6.71 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|