C18H26N2 — CID 102726902
(4aR,8aR)-1-(2,3-dihydro-1H-indol-5-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 102726902) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (4aR,8aR)-1-(2,3-dihydro-1H-indol-5-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aR)-1-(2,3-dihydro-1H-indol-5-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 102726902 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (4aR,8aR)-1-(2,3-dihydro-1H-indol-5-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | c1cc2c(cc1CN1CCC[C@H]3CCCC[C@H]31)CCN2 |
| InChI | InChI=1S/C18H26N2/c1-2-6-18-15(4-1)5-3-11-20(18)13-14-7-8-17-16(12-14)9-10-19-17/h7-8,12,15,18-19H,1-6,9-11,13H2/t15-,18-/m1/s1 |
| InChIKey | CQPGVABTQKSPFU-CRAIPNDOSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |