C23H22N2O5 — CID 10272704
5,5-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)pentan-1-ol (PubChem CID 10272704) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 5,5-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)pentan-1-ol.
| Compound Name | 5,5-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)pentan-1-ol |
|---|---|
| PubChem CID | 10272704 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 5,5-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)pentan-1-ol |
| SMILES | OCCCCC(c1c[nH]c2cc3c(cc12)OCO3)c1c[nH]c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C23H22N2O5/c26-4-2-1-3-13(16-9-24-18-7-22-20(5-14(16)18)27-11-29-22)17-10-25-19-8-23-21(6-15(17)19)28-12-30-23/h5-10,13,24-26H,1-4,11-12H2 |
| InChIKey | DANQJLAJEHUMNS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|