C18H25NO2 — CID 102727074
2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]acetic acid (PubChem CID 102727074) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 102727074 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CN1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H25NO2/c20-18(21)12-15-7-1-2-8-16(15)13-19-11-5-9-14-6-3-4-10-17(14)19/h1-2,7-8,14,17H,3-6,9-13H2,(H,20,21)/t14-,17-/m1/s1 |
| InChIKey | OVGOKNXTBOEHGA-RHSMWYFYSA-N |
| XLogP | 3.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |