C16H23NOS — CID 102727266
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(5-methylthiophen-2-yl)ethanone (PubChem CID 102727266) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(5-methylthiophen-2-yl)ethanone.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(5-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 102727266 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(5-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccc(C(=O)CN2CCC[C@H]3CCCC[C@H]32)s1 |
| InChI | InChI=1S/C16H23NOS/c1-12-8-9-16(19-12)15(18)11-17-10-4-6-13-5-2-3-7-14(13)17/h8-9,13-14H,2-7,10-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | CJVIXBREPWYGQG-ZIAGYGMSSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |