C27H26N4 — CID 10272736
N-benzyl-2-(1H-indol-3-yl)-1-(5-methyl-4-phenyl-1H-imidazol-2-yl)ethanamine (PubChem CID 10272736) has the molecular formula C27H26N4 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-benzyl-2-(1H-indol-3-yl)-1-(5-methyl-4-phenyl-1H-imidazol-2-yl)ethanamine.
| Compound Name | N-benzyl-2-(1H-indol-3-yl)-1-(5-methyl-4-phenyl-1H-imidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 10272736 |
| Molecular Formula | C27H26N4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-benzyl-2-(1H-indol-3-yl)-1-(5-methyl-4-phenyl-1H-imidazol-2-yl)ethanamine |
| SMILES | Cc1[nH]c(C(Cc2c[nH]c3ccccc23)NCc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H26N4/c1-19-26(21-12-6-3-7-13-21)31-27(30-19)25(28-17-20-10-4-2-5-11-20)16-22-18-29-24-15-9-8-14-23(22)24/h2-15,18,25,28-29H,16-17H2,1H3,(H,30,31) |
| InChIKey | PHIGPUKLLCGMJQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |