C16H22N2O2 — CID 102727707
4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-aminobenzoic acid (PubChem CID 102727707) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-aminobenzoic acid.
| Compound Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-aminobenzoic acid |
|---|---|
| PubChem CID | 102727707 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-aminobenzoic acid |
| SMILES | Nc1cc(N2CCC[C@H]3CCCC[C@H]32)ccc1C(=O)O |
| InChI | InChI=1S/C16H22N2O2/c17-14-10-12(7-8-13(14)16(19)20)18-9-3-5-11-4-1-2-6-15(11)18/h7-8,10-11,15H,1-6,9,17H2,(H,19,20)/t11-,15-/m1/s1 |
| InChIKey | ONJUQJBJEZRIEF-IAQYHMDHSA-N |
| XLogP | 3.13 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|