C16H27N3S — CID 102728727
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-propyl-1,3-thiazol-5-yl]methanamine (PubChem CID 102728727) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-propyl-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-propyl-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 102728727 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-propyl-1,3-thiazol-5-yl]methanamine |
| SMILES | CCCc1nc(N2CCC[C@H]3CCCC[C@H]32)sc1CN |
| InChI | InChI=1S/C16H27N3S/c1-2-6-13-15(11-17)20-16(18-13)19-10-5-8-12-7-3-4-9-14(12)19/h12,14H,2-11,17H2,1H3/t12-,14-/m1/s1 |
| InChIKey | KEVFXGUSVHGTBL-TZMCWYRMSA-N |
| XLogP | 3.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |