C18H32N2O — CID 102728751
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,4-dimethylcyclohexyl)methanone (PubChem CID 102728751) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,4-dimethylcyclohexyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 102728751 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CC(C)C(C(=O)N2CCC[C@H]3CCCC[C@H]32)CC1N |
| InChI | InChI=1S/C18H32N2O/c1-12-10-13(2)16(19)11-15(12)18(21)20-9-5-7-14-6-3-4-8-17(14)20/h12-17H,3-11,19H2,1-2H3/t12?,13?,14-,15?,16?,17-/m1/s1 |
| InChIKey | SCVPMHPOQWKDPN-QXEBHSJCSA-N |
| XLogP | 3.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |