C16H32N2O2S — CID 102729039
4-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-N-propan-2-ylbutan-1-amine (PubChem CID 102729039) has the molecular formula C16H32N2O2S and a molecular weight of 316.51 g/mol. Its IUPAC name is 4-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-N-propan-2-ylbutan-1-amine.
| Compound Name | 4-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 102729039 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-N-propan-2-ylbutan-1-amine |
| SMILES | CC(C)NCCCCS(=O)(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H32N2O2S/c1-14(2)17-11-5-6-13-21(19,20)18-12-7-9-15-8-3-4-10-16(15)18/h14-17H,3-13H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | LBEFHYWBAKVSOH-HZPDHXFCSA-N |
| XLogP | 2.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|