C16H26N4 — CID 102729117
6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,2,5-trimethylpyrimidin-4-amine (PubChem CID 102729117) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,2,5-trimethylpyrimidin-4-amine.
| Compound Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,2,5-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102729117 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N,2,5-trimethylpyrimidin-4-amine |
| SMILES | CNc1nc(C)nc(N2CCC[C@H]3CCCC[C@H]32)c1C |
| InChI | InChI=1S/C16H26N4/c1-11-15(17-3)18-12(2)19-16(11)20-10-6-8-13-7-4-5-9-14(13)20/h13-14H,4-10H2,1-3H3,(H,17,18,19)/t13-,14-/m1/s1 |
| InChIKey | BHJUVBUIIWFSME-ZIAGYGMSSA-N |
| XLogP | 3.29 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |