C16H24N4 — CID 102729187
6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-cyclopropylpyrimidin-4-amine (PubChem CID 102729187) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-cyclopropylpyrimidin-4-amine.
| Compound Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102729187 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-cyclopropylpyrimidin-4-amine |
| SMILES | Nc1cc(N2CCC[C@H]3CCCC[C@H]32)nc(C2CC2)n1 |
| InChI | InChI=1S/C16H24N4/c17-14-10-15(19-16(18-14)12-7-8-12)20-9-3-5-11-4-1-2-6-13(11)20/h10-13H,1-9H2,(H2,17,18,19)/t11-,13-/m1/s1 |
| InChIKey | YOXPMIATUNDRDW-DGCLKSJQSA-N |
| XLogP | 3.10 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |