C13H26N4O — CID 102729291
(4aR,8aR)-N-amino-N'-(2-methoxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide (PubChem CID 102729291) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is (4aR,8aR)-N-amino-N'-(2-methoxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide.
| Compound Name | (4aR,8aR)-N-amino-N'-(2-methoxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 102729291 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (4aR,8aR)-N-amino-N'-(2-methoxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
| SMILES | COCC/N=C(\NN)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H26N4O/c1-18-10-8-15-13(16-14)17-9-4-6-11-5-2-3-7-12(11)17/h11-12H,2-10,14H2,1H3,(H,15,16)/t11-,12-/m1/s1 |
| InChIKey | YKVNNZTXRMBKAQ-VXGBXAGGSA-N |
| XLogP | 1.11 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|