C13H21N3O2 — CID 102729342
4-(4-aminocyclohexyl)oxy-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 102729342) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(4-aminocyclohexyl)oxy-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(4-aminocyclohexyl)oxy-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 102729342 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-(4-aminocyclohexyl)oxy-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(OC2CCC(N)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H21N3O2/c1-8(2)13-15-11(17)7-12(16-13)18-10-5-3-9(14)4-6-10/h7-10H,3-6,14H2,1-2H3,(H,15,16,17) |
| InChIKey | WFXIYIHBJRRDBO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |