About (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate
(4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 102729390) has the molecular formula C9H15F3N2O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate.
Molecular Properties
| Compound Name | (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate |
| PubChem CID | 102729390 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | NC1CCC(OC(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3N2O2/c10-9(11,12)5-14-8(15)16-7-3-1-6(13)2-4-7/h6-7H,1-5,13H2,(H,14,15) |
| InChIKey | KWIHSNHAYMQPEJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate?
The IUPAC name of (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate (CID 102729390) is (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate.
What is the SMILES notation for (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate?
The canonical SMILES for (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate is NC1CCC(OC(=O)NCC(F)(F)F)CC1.
What is the InChIKey of (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate?
The InChIKey is KWIHSNHAYMQPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2/c10-9(11,12)5-14-8(15)16-7-3-1-6(13)2-4-7/h6-7H,1-5,13H2,(H,14,15).
What are the key properties of (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate?
(4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate has a molecular weight of 240.22 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminocyclohexyl) N-(2,2,2-trifluoroethyl)carbamate is sourced from PubChem (CID 102729390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).