C17H35N3O2 — CID 102729640
tert-butyl N-[4-amino-3-[cycloheptyl(methyl)amino]butan-2-yl]carbamate (PubChem CID 102729640) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[cycloheptyl(methyl)amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[cycloheptyl(methyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102729640 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | tert-butyl N-[4-amino-3-[cycloheptyl(methyl)amino]butan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(CN)N(C)C1CCCCCC1 |
| InChI | InChI=1S/C17H35N3O2/c1-13(19-16(21)22-17(2,3)4)15(12-18)20(5)14-10-8-6-7-9-11-14/h13-15H,6-12,18H2,1-5H3,(H,19,21) |
| InChIKey | LGKYWTASUDLVRT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |