C15H26BrN3O2S — CID 102729812
tert-butyl N-[4-amino-3-[(5-bromothiophen-3-yl)methyl-methylamino]butyl]carbamate (PubChem CID 102729812) has the molecular formula C15H26BrN3O2S and a molecular weight of 392.36 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[(5-bromothiophen-3-yl)methyl-methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[(5-bromothiophen-3-yl)methyl-methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 102729812 |
| Molecular Formula | C15H26BrN3O2S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | tert-butyl N-[4-amino-3-[(5-bromothiophen-3-yl)methyl-methylamino]butyl]carbamate |
| SMILES | CN(Cc1csc(Br)c1)C(CN)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26BrN3O2S/c1-15(2,3)21-14(20)18-6-5-12(8-17)19(4)9-11-7-13(16)22-10-11/h7,10,12H,5-6,8-9,17H2,1-4H3,(H,18,20) |
| InChIKey | PLWBTTWDOYTHGU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |