C14H24BrN3O2S — CID 102729813
tert-butyl N-[3-amino-2-[(5-bromothiophen-3-yl)methyl-methylamino]propyl]carbamate (PubChem CID 102729813) has the molecular formula C14H24BrN3O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[(5-bromothiophen-3-yl)methyl-methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[(5-bromothiophen-3-yl)methyl-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 102729813 |
| Molecular Formula | C14H24BrN3O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | tert-butyl N-[3-amino-2-[(5-bromothiophen-3-yl)methyl-methylamino]propyl]carbamate |
| SMILES | CN(Cc1csc(Br)c1)C(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24BrN3O2S/c1-14(2,3)20-13(19)17-7-11(6-16)18(4)8-10-5-12(15)21-9-10/h5,9,11H,6-8,16H2,1-4H3,(H,17,19) |
| InChIKey | LIJASNDLESNQGR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |