C27H25NO3 — CID 10273044
2-phenyl-3-(3,4,5-trimethoxyphenyl)-4,5-dihydrobenzo[e]indole (PubChem CID 10273044) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-phenyl-3-(3,4,5-trimethoxyphenyl)-4,5-dihydrobenzo[e]indole.
| Compound Name | 2-phenyl-3-(3,4,5-trimethoxyphenyl)-4,5-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 10273044 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-phenyl-3-(3,4,5-trimethoxyphenyl)-4,5-dihydrobenzo[e]indole |
| SMILES | COc1cc(-n2c(-c3ccccc3)cc3c2CCc2ccccc2-3)cc(OC)c1OC |
| InChI | InChI=1S/C27H25NO3/c1-29-25-15-20(16-26(30-2)27(25)31-3)28-23-14-13-18-9-7-8-12-21(18)22(23)17-24(28)19-10-5-4-6-11-19/h4-12,15-17H,13-14H2,1-3H3 |
| InChIKey | URAJVKJFBBAAFB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|