C13H23NO — CID 102731118
trans-(1S,2S)-2-(dicyclopropylmethylamino)cyclohexan-1-ol (PubChem CID 102731118) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is trans-(1S,2S)-2-(dicyclopropylmethylamino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(dicyclopropylmethylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731118 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | trans-(1S,2S)-2-(dicyclopropylmethylamino)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C13H23NO/c15-12-4-2-1-3-11(12)14-13(9-5-6-9)10-7-8-10/h9-15H,1-8H2/t11-,12-/m0/s1 |
| InChIKey | YKLZFYZPMGCPHA-RYUDHWBXSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |