C11H20F3NO — CID 102731534
trans-(1R,2R)-2-(5,5,5-trifluoropentylamino)cyclohexan-1-ol (PubChem CID 102731534) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-(5,5,5-trifluoropentylamino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(5,5,5-trifluoropentylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731534 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | trans-(1R,2R)-2-(5,5,5-trifluoropentylamino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c12-11(13,14)7-3-4-8-15-9-5-1-2-6-10(9)16/h9-10,15-16H,1-8H2/t9-,10-/m1/s1 |
| InChIKey | RPXPNVKLIAIRHQ-NXEZZACHSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|