C12H23NO2 — CID 102731768
trans-(1R,2R)-2-[2-(2-methylprop-2-enoxy)ethylamino]cyclohexan-1-ol (PubChem CID 102731768) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-(2-methylprop-2-enoxy)ethylamino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[2-(2-methylprop-2-enoxy)ethylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731768 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | trans-(1R,2R)-2-[2-(2-methylprop-2-enoxy)ethylamino]cyclohexan-1-ol |
| SMILES | C=C(C)COCCN[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H23NO2/c1-10(2)9-15-8-7-13-11-5-3-4-6-12(11)14/h11-14H,1,3-9H2,2H3/t11-,12-/m1/s1 |
| InChIKey | TXLPVVBYXGKDTJ-VXGBXAGGSA-N |
| XLogP | 1.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|