About 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile
3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile (PubChem CID 102732026) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile |
| PubChem CID | 102732026 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H20N2O/c1-9(7-12)8-13(2)10-5-3-4-6-11(10)14/h9-11,14H,3-6,8H2,1-2H3/t9?,10-,11-/m1/s1 |
| InChIKey | HSPBXEWAANKLTH-FHZGLPGMSA-N |
| XLogP | 1.38 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile?
The IUPAC name of 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile (CID 102732026) is 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile.
What is the SMILES notation for 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile?
The canonical SMILES for 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile is CC(C#N)CN(C)[C@@H]1CCCC[C@H]1O.
What is the InChIKey of 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile?
The InChIKey is HSPBXEWAANKLTH-FHZGLPGMSA-N. The full InChI is InChI=1S/C11H20N2O/c1-9(7-12)8-13(2)10-5-3-4-6-11(10)14/h9-11,14H,3-6,8H2,1-2H3/t9?,10-,11-/m1/s1.
What are the key properties of 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile?
3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile has a molecular weight of 196.29 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]-2-methylpropanenitrile is sourced from PubChem (CID 102732026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).