About 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile
1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile (PubChem CID 102732435) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile |
| PubChem CID | 102732435 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn([C@H]2CCCC[C@@H]2O)c1C#N |
| InChI | InChI=1S/C11H12N4O/c12-5-8-10(6-13)15(7-14-8)9-3-1-2-4-11(9)16/h7,9,11,16H,1-4H2/t9-,11-/m0/s1 |
| InChIKey | JRWIHWGTHRWBCS-ONGXEEELSA-N |
| XLogP | 1.10 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile (CID 102732435) is 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile is N#Cc1ncn([C@H]2CCCC[C@@H]2O)c1C#N.
What is the InChIKey of 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile?
The InChIKey is JRWIHWGTHRWBCS-ONGXEEELSA-N. The full InChI is InChI=1S/C11H12N4O/c12-5-8-10(6-13)15(7-14-8)9-3-1-2-4-11(9)16/h7,9,11,16H,1-4H2/t9-,11-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile?
1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile has a molecular weight of 216.24 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-hydroxycyclohexyl]imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 102732435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).