C12H16BrNO — CID 102733136
trans-(1R,2R)-2-(5-bromo-2-methylanilino)cyclopentan-1-ol (PubChem CID 102733136) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is trans-(1R,2R)-2-(5-bromo-2-methylanilino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(5-bromo-2-methylanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733136 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | trans-(1R,2R)-2-(5-bromo-2-methylanilino)cyclopentan-1-ol |
| SMILES | Cc1ccc(Br)cc1N[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C12H16BrNO/c1-8-5-6-9(13)7-11(8)14-10-3-2-4-12(10)15/h5-7,10,12,14-15H,2-4H2,1H3/t10-,12-/m1/s1 |
| InChIKey | NKGWCLSWKYJPDT-ZYHUDNBSSA-N |
| XLogP | 3.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |