C17H17ClF3N5O2 — CID 10273342
3-chloro-N-[2-[2-(pyridine-3-carbonylamino)ethylamino]ethyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 10273342) has the molecular formula C17H17ClF3N5O2 and a molecular weight of 415.80 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(pyridine-3-carbonylamino)ethylamino]ethyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[2-(pyridine-3-carbonylamino)ethylamino]ethyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10273342 |
| Molecular Formula | C17H17ClF3N5O2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-chloro-N-[2-[2-(pyridine-3-carbonylamino)ethylamino]ethyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCNCCNC(=O)c1ncc(C(F)(F)F)cc1Cl)c1cccnc1 |
| InChI | InChI=1S/C17H17ClF3N5O2/c18-13-8-12(17(19,20)21)10-26-14(13)16(28)25-7-5-22-4-6-24-15(27)11-2-1-3-23-9-11/h1-3,8-10,22H,4-7H2,(H,24,27)(H,25,28) |
| InChIKey | RDWPZOYCAWOXCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|