About 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione
3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione (PubChem CID 102733656) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione |
| PubChem CID | 102733656 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(N[C@@H]2CCC[C@H]2O)C1=O |
| InChI | InChI=1S/C11H18N2O3/c1-13-10(15)6-5-8(11(13)16)12-7-3-2-4-9(7)14/h7-9,12,14H,2-6H2,1H3/t7-,8?,9-/m1/s1 |
| InChIKey | BGBNOKXDEFQMDD-PSGOWDBMSA-N |
| XLogP | -0.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione?
The IUPAC name of 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione (CID 102733656) is 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione.
What is the SMILES notation for 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione?
The canonical SMILES for 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione is CN1C(=O)CCC(N[C@@H]2CCC[C@H]2O)C1=O.
What is the InChIKey of 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione?
The InChIKey is BGBNOKXDEFQMDD-PSGOWDBMSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-13-10(15)6-5-8(11(13)16)12-7-3-2-4-9(7)14/h7-9,12,14H,2-6H2,1H3/t7-,8?,9-/m1/s1.
What are the key properties of 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione?
3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione has a molecular weight of 226.28 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-methylpiperidine-2,6-dione is sourced from PubChem (CID 102733656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).