About trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol
trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol (PubChem CID 102734534) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol |
| PubChem CID | 102734534 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol |
| SMILES | O=S1CCN([C@@H]2CCC[C@H]2O)CC1 |
| InChI | InChI=1S/C9H17NO2S/c11-9-3-1-2-8(9)10-4-6-13(12)7-5-10/h8-9,11H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | CCZVYUWUKGCFTQ-RKDXNWHRSA-N |
| XLogP | -0.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol (CID 102734534) is trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol is O=S1CCN([C@@H]2CCC[C@H]2O)CC1.
What is the InChIKey of trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol?
The InChIKey is CCZVYUWUKGCFTQ-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H17NO2S/c11-9-3-1-2-8(9)10-4-6-13(12)7-5-10/h8-9,11H,1-7H2/t8-,9-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol?
trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol has a molecular weight of 203.31 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(1-oxo-1,4-thiazinan-4-yl)cyclopentan-1-ol is sourced from PubChem (CID 102734534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).