C25H43N3O2 — CID 10273480
3-amino-4-cyclohexyl-2-hydroxy-N'-phenyl-N'-(3,5,5-trimethylhexyl)butanehydrazide (PubChem CID 10273480) has the molecular formula C25H43N3O2 and a molecular weight of 417.64 g/mol. Its IUPAC name is 3-amino-4-cyclohexyl-2-hydroxy-N'-phenyl-N'-(3,5,5-trimethylhexyl)butanehydrazide.
| Compound Name | 3-amino-4-cyclohexyl-2-hydroxy-N'-phenyl-N'-(3,5,5-trimethylhexyl)butanehydrazide |
|---|---|
| PubChem CID | 10273480 |
| Molecular Formula | C25H43N3O2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 3-amino-4-cyclohexyl-2-hydroxy-N'-phenyl-N'-(3,5,5-trimethylhexyl)butanehydrazide |
| SMILES | CC(CCN(NC(=O)C(O)C(N)CC1CCCCC1)c1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C25H43N3O2/c1-19(18-25(2,3)4)15-16-28(21-13-9-6-10-14-21)27-24(30)23(29)22(26)17-20-11-7-5-8-12-20/h6,9-10,13-14,19-20,22-23,29H,5,7-8,11-12,15-18,26H2,1-4H3,(H,27,30) |
| InChIKey | ALGBNOGQFNKXTQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|