C10H13F3N2O3 — CID 102735180
3-[(1S,2S)-2-hydroxycyclopentyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 102735180) has the molecular formula C10H13F3N2O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 3-[(1S,2S)-2-hydroxycyclopentyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2S)-2-hydroxycyclopentyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 102735180 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-[(1S,2S)-2-hydroxycyclopentyl]-5-methyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C(F)(F)F)NC(=O)N([C@H]2CCC[C@@H]2O)C1=O |
| InChI | InChI=1S/C10H13F3N2O3/c1-9(10(11,12)13)7(17)15(8(18)14-9)5-3-2-4-6(5)16/h5-6,16H,2-4H2,1H3,(H,14,18)/t5-,6-,9?/m0/s1 |
| InChIKey | VZFVGFSGGOVXDW-NCYRLESRSA-N |
| XLogP | 0.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|