About 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one
5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one (PubChem CID 102735282) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one |
| PubChem CID | 102735282 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one |
| SMILES | CN(C)c1cnn([C@H]2CCC[C@@H]2O)c(=O)c1 |
| InChI | InChI=1S/C11H17N3O2/c1-13(2)8-6-11(16)14(12-7-8)9-4-3-5-10(9)15/h6-7,9-10,15H,3-5H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | KUSKKZHHQWVKPB-UWVGGRQHSA-N |
| XLogP | 0.40 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one?
The IUPAC name of 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one (CID 102735282) is 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one.
What is the SMILES notation for 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one?
The canonical SMILES for 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one is CN(C)c1cnn([C@H]2CCC[C@@H]2O)c(=O)c1.
What is the InChIKey of 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one?
The InChIKey is KUSKKZHHQWVKPB-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-13(2)8-6-11(16)14(12-7-8)9-4-3-5-10(9)15/h6-7,9-10,15H,3-5H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one?
5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one has a molecular weight of 223.28 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one is sourced from PubChem (CID 102735282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).