About 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one
2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (PubChem CID 102735286) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| PubChem CID | 102735286 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| SMILES | COCCN(C)c1cnn([C@H]2CCC[C@@H]2O)c(=O)c1 |
| InChI | InChI=1S/C13H21N3O3/c1-15(6-7-19-2)10-8-13(18)16(14-9-10)11-4-3-5-12(11)17/h8-9,11-12,17H,3-7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | SKOISNATVRAJOD-RYUDHWBXSA-N |
| XLogP | 0.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one?
The IUPAC name of 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (CID 102735286) is 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
What is the SMILES notation for 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one?
The canonical SMILES for 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one is COCCN(C)c1cnn([C@H]2CCC[C@@H]2O)c(=O)c1.
What is the InChIKey of 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one?
The InChIKey is SKOISNATVRAJOD-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-15(6-7-19-2)10-8-13(18)16(14-9-10)11-4-3-5-12(11)17/h8-9,11-12,17H,3-7H2,1-2H3/t11-,12-/m0/s1.
What are the key properties of 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one?
2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one has a molecular weight of 267.33 g/mol, XLogP of 0.41, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S)-2-hydroxycyclopentyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one is sourced from PubChem (CID 102735286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).