C13H21N3O2 — CID 102735288
5-(diethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one (PubChem CID 102735288) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one.
| Compound Name | 5-(diethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one |
|---|---|
| PubChem CID | 102735288 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5-(diethylamino)-2-[(1S,2S)-2-hydroxycyclopentyl]pyridazin-3-one |
| SMILES | CCN(CC)c1cnn([C@H]2CCC[C@@H]2O)c(=O)c1 |
| InChI | InChI=1S/C13H21N3O2/c1-3-15(4-2)10-8-13(18)16(14-9-10)11-6-5-7-12(11)17/h8-9,11-12,17H,3-7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | KWFSIGZSVVBHRW-RYUDHWBXSA-N |
| XLogP | 1.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |