C20H23Cl2FN4O — CID 1027354
2,2-dichloro-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 1027354) has the molecular formula C20H23Cl2FN4O and a molecular weight of 425.34 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 1027354 |
| Molecular Formula | C20H23Cl2FN4O |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2,2-dichloro-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | Cc1nc(C)c(Cc2cccc(F)c2)c(N2CCCN(C(=O)C(Cl)Cl)CC2)n1 |
| InChI | InChI=1S/C20H23Cl2FN4O/c1-13-17(12-15-5-3-6-16(23)11-15)19(25-14(2)24-13)26-7-4-8-27(10-9-26)20(28)18(21)22/h3,5-6,11,18H,4,7-10,12H2,1-2H3 |
| InChIKey | GVMKFFJMJPWPFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|