C23H28Cl2N2O — CID 10273553
8-(2,4-dichlorophenyl)-N,N-dipropyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridin-6-amine (PubChem CID 10273553) has the molecular formula C23H28Cl2N2O and a molecular weight of 419.40 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-N,N-dipropyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridin-6-amine.
| Compound Name | 8-(2,4-dichlorophenyl)-N,N-dipropyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 10273553 |
| Molecular Formula | C23H28Cl2N2O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-N,N-dipropyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridin-6-amine |
| SMILES | CCCN(CCC)c1cc(-c2ccc(Cl)cc2Cl)cc2c1OC1CCNCC21 |
| InChI | InChI=1S/C23H28Cl2N2O/c1-3-9-27(10-4-2)21-12-15(17-6-5-16(24)13-20(17)25)11-18-19-14-26-8-7-22(19)28-23(18)21/h5-6,11-13,19,22,26H,3-4,7-10,14H2,1-2H3 |
| InChIKey | WCKJDMWREREAGC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |