C12H15ClO2 — CID 102735536
trans-(1S,2S)-2-(5-chloro-2-methylphenoxy)cyclopentan-1-ol (PubChem CID 102735536) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is trans-(1S,2S)-2-(5-chloro-2-methylphenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(5-chloro-2-methylphenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735536 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | trans-(1S,2S)-2-(5-chloro-2-methylphenoxy)cyclopentan-1-ol |
| SMILES | Cc1ccc(Cl)cc1O[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C12H15ClO2/c1-8-5-6-9(13)7-12(8)15-11-4-2-3-10(11)14/h5-7,10-11,14H,2-4H2,1H3/t10-,11-/m0/s1 |
| InChIKey | XRHGHZDJFGQFSP-QWRGUYRKSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |