About N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide
N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide (PubChem CID 10273599) has the molecular formula C20H19ClFN3O4
and a molecular weight of 419.84 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide |
| PubChem CID | 10273599 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nn2c(C)cnc2-c2c(F)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C20H19ClFN3O4/c1-11-10-23-19(17-13(21)6-5-7-14(17)22)25(11)24-20(26)12-8-15(27-2)18(29-4)16(9-12)28-3/h5-10H,1-4H3,(H,24,26) |
| InChIKey | RFLOGJKWIRNHSS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide?
The IUPAC name of N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide (CID 10273599) is N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide.
What is the SMILES notation for N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide?
The canonical SMILES for N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide is COc1cc(C(=O)Nn2c(C)cnc2-c2c(F)cccc2Cl)cc(OC)c1OC.
What is the InChIKey of N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide?
The InChIKey is RFLOGJKWIRNHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClFN3O4/c1-11-10-23-19(17-13(21)6-5-7-14(17)22)25(11)24-20(26)12-8-15(27-2)18(29-4)16(9-12)28-3/h5-10H,1-4H3,(H,24,26).
What are the key properties of N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide?
N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide has a molecular weight of 419.84 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-chloro-6-fluorophenyl)-5-methylimidazol-1-yl]-3,4,5-trimethoxybenzamide is sourced from PubChem (CID 10273599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).