About N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide
N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide (PubChem CID 102736014) has the molecular formula C13H24F3N3O
and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide |
| PubChem CID | 102736014 |
| Molecular Formula | C13H24F3N3O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide |
| SMILES | CCC(N)C(N1CCC(CNC(C)=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H24F3N3O/c1-3-11(17)12(13(14,15)16)19-6-4-10(5-7-19)8-18-9(2)20/h10-12H,3-8,17H2,1-2H3,(H,18,20) |
| InChIKey | YPBGNSAJHOHQQL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide?
The IUPAC name of N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide (CID 102736014) is N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide.
What is the SMILES notation for N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide?
The canonical SMILES for N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide is CCC(N)C(N1CCC(CNC(C)=O)CC1)C(F)(F)F.
What is the InChIKey of N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide?
The InChIKey is YPBGNSAJHOHQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F3N3O/c1-3-11(17)12(13(14,15)16)19-6-4-10(5-7-19)8-18-9(2)20/h10-12H,3-8,17H2,1-2H3,(H,18,20).
What are the key properties of N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide?
N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide has a molecular weight of 295.35 g/mol, XLogP of 1.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3-amino-1,1,1-trifluoropentan-2-yl)piperidin-4-yl]methyl]acetamide is sourced from PubChem (CID 102736014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).